C18H30N4O4S — CID 119131966
N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 119131966) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119131966 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | O=C(C1CCCO1)N1CCN(/C(=N\CC2CCS(=O)(=O)C2)NC2CC2)CC1 |
| InChI | InChI=1S/C18H30N4O4S/c23-17(16-2-1-10-26-16)21-6-8-22(9-7-21)18(20-15-3-4-15)19-12-14-5-11-27(24,25)13-14/h14-16H,1-13H2,(H,19,20) |
| InChIKey | VGKNWFCIWSBINB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|