C20H29FIN3O2S — CID 119143653
N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-3-[(4-fluorophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119143653) has the molecular formula C20H29FIN3O2S and a molecular weight of 521.44 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-3-[(4-fluorophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-3-[(4-fluorophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119143653 |
| Molecular Formula | C20H29FIN3O2S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-cyclopropyl-N'-[(1,1-dioxothiolan-3-yl)methyl]-3-[(4-fluorophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | I.O=S1(=O)CCC(C/N=C(/NC2CC2)N2CCC(Cc3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C20H28FN3O2S.HI/c21-18-3-1-15(2-4-18)11-16-7-9-24(13-16)20(23-19-5-6-19)22-12-17-8-10-27(25,26)14-17;/h1-4,16-17,19H,5-14H2,(H,22,23);1H |
| InChIKey | AUQTYJDIOPCWGA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|