C20H23FN4O — CID 119132086
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine (PubChem CID 119132086) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119132086 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCN1C(=O)Cc2ccccc21)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4O/c1-22-20(24(2)14-15-7-9-17(21)10-8-15)23-11-12-25-18-6-4-3-5-16(18)13-19(25)26/h3-10H,11-14H2,1-2H3,(H,22,23) |
| InChIKey | INNJQSSGGJYFRX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|