C17H23N5O — CID 119136123
4-[(6-cyanoimidazo[1,2-a]pyridin-3-yl)methylamino]-N,N-diethylbutanamide (PubChem CID 119136123) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-[(6-cyanoimidazo[1,2-a]pyridin-3-yl)methylamino]-N,N-diethylbutanamide.
| Compound Name | 4-[(6-cyanoimidazo[1,2-a]pyridin-3-yl)methylamino]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 119136123 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-[(6-cyanoimidazo[1,2-a]pyridin-3-yl)methylamino]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCNCc1cnc2ccc(C#N)cn12 |
| InChI | InChI=1S/C17H23N5O/c1-3-21(4-2)17(23)6-5-9-19-11-15-12-20-16-8-7-14(10-18)13-22(15)16/h7-8,12-13,19H,3-6,9,11H2,1-2H3 |
| InChIKey | MGUVQLPIOBSEPU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|