C15H21N3O — CID 54934968
3-[(3-cyanophenyl)methylamino]-N,N-diethylpropanamide (PubChem CID 54934968) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)methylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[(3-cyanophenyl)methylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 54934968 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-[(3-cyanophenyl)methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H21N3O/c1-3-18(4-2)15(19)8-9-17-12-14-7-5-6-13(10-14)11-16/h5-7,10,17H,3-4,8-9,12H2,1-2H3 |
| InChIKey | RNQRBLYLYWPHNS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|