C14H16F3N3O — CID 51100896
3-[(3-cyanophenyl)methyl]-1-ethyl-1-(3,3,3-trifluoropropyl)urea (PubChem CID 51100896) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)methyl]-1-ethyl-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(3-cyanophenyl)methyl]-1-ethyl-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 51100896 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-[(3-cyanophenyl)methyl]-1-ethyl-1-(3,3,3-trifluoropropyl)urea |
| SMILES | CCN(CCC(F)(F)F)C(=O)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H16F3N3O/c1-2-20(7-6-14(15,16)17)13(21)19-10-12-5-3-4-11(8-12)9-18/h3-5,8H,2,6-7,10H2,1H3,(H,19,21) |
| InChIKey | AKQGKDIOYJIHFR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |