C18H24N2O5S — CID 119136308
1-[2-[benzenesulfonyl(methyl)amino]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119136308) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[2-[benzenesulfonyl(methyl)amino]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[2-[benzenesulfonyl(methyl)amino]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119136308 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[2-[benzenesulfonyl(methyl)amino]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CN(CC(=O)N1C(C(=O)O)CC2CCCCC21)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-19(26(24,25)14-8-3-2-4-9-14)12-17(21)20-15-10-6-5-7-13(15)11-16(20)18(22)23/h2-4,8-9,13,15-16H,5-7,10-12H2,1H3,(H,22,23) |
| InChIKey | RHPGIQOZKWTHTI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |