C20H27NO5S — CID 125132369
(2S,3aS,7aR)-1-[2-(3-phenylpropylsulfonyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125132369) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2S,3aS,7aR)-1-[2-(3-phenylpropylsulfonyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aR)-1-[2-(3-phenylpropylsulfonyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125132369 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2S,3aS,7aR)-1-[2-(3-phenylpropylsulfonyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2CCCC[C@H]2N1C(=O)CS(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C20H27NO5S/c22-19(14-27(25,26)12-6-9-15-7-2-1-3-8-15)21-17-11-5-4-10-16(17)13-18(21)20(23)24/h1-3,7-8,16-18H,4-6,9-14H2,(H,23,24)/t16-,17+,18-/m0/s1 |
| InChIKey | IJAKLYFIDYHWCX-KSZLIROESA-N |
| XLogP | 2.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |