C17H30N4O2 — CID 119141674
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 119141674) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119141674 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCCN1C)NCC(C)(O)c1cc(C)oc1C |
| InChI | InChI=1S/C17H30N4O2/c1-12-9-15(13(2)23-12)17(3,22)11-20-16(18-4)19-10-14-7-6-8-21(14)5/h9,14,22H,6-8,10-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | DZBPQEUHEYDZNK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|