C14H23BrIN3O2 — CID 119141696
1-(2-bromoprop-2-enyl)-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide (PubChem CID 119141696) has the molecular formula C14H23BrIN3O2 and a molecular weight of 472.17 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-bromoprop-2-enyl)-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119141696 |
| Molecular Formula | C14H23BrIN3O2 |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
| SMILES | C=C(Br)CN/C(=N\C)NCC(C)(O)c1cc(C)oc1C.I |
| InChI | InChI=1S/C14H22BrN3O2.HI/c1-9(15)7-17-13(16-5)18-8-14(4,19)12-6-10(2)20-11(12)3;/h6,19H,1,7-8H2,2-5H3,(H2,16,17,18);1H |
| InChIKey | VDOUATWQBYIFPC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|