C17H31IN4O3 — CID 119141688
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119141688) has the molecular formula C17H31IN4O3 and a molecular weight of 466.36 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141688 |
| Molecular Formula | C17H31IN4O3 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CN(C)CCO1)NCC(C)(O)c1cc(C)oc1C.I |
| InChI | InChI=1S/C17H30N4O3.HI/c1-12-8-15(13(2)24-12)17(3,22)11-20-16(18-4)19-9-14-10-21(5)6-7-23-14;/h8,14,22H,6-7,9-11H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | FJBMMSGRMJYRKK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|