C17H31IN4O — CID 119144021
N-[2-[cyclopropyl(methyl)amino]propyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144021) has the molecular formula C17H31IN4O and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[2-[cyclopropyl(methyl)amino]propyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[2-[cyclopropyl(methyl)amino]propyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144021 |
| Molecular Formula | C17H31IN4O |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[2-[cyclopropyl(methyl)amino]propyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)N(C)C1CC1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C17H30N4O.HI/c1-11(20(3)12-4-5-12)8-19-17(18-2)21-9-13-14(10-21)16-7-6-15(13)22-16;/h11-16H,4-10H2,1-3H3,(H,18,19);1H |
| InChIKey | QHMPHMIZLMGIHV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|