C14H27IN4O3S — CID 119144065
N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144065) has the molecular formula C14H27IN4O3S and a molecular weight of 458.37 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144065 |
| Molecular Formula | C14H27IN4O3S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C14H26N4O3S.HI/c1-3-22(19,20)17-7-6-16-14(15-2)18-8-10-11(9-18)13-5-4-12(10)21-13;/h10-13,17H,3-9H2,1-2H3,(H,15,16);1H |
| InChIKey | DTAIFPWGONFILC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|