C19H32N4O2 — CID 119143994
3-[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-cyclohexylpropanamide (PubChem CID 119143994) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 119143994 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 3-[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]-N-cyclohexylpropanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCCCC1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C19H32N4O2/c1-20-19(21-10-9-18(24)22-13-5-3-2-4-6-13)23-11-14-15(12-23)17-8-7-16(14)25-17/h13-17H,2-12H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | BOJDJWZSQZPJCW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|