C20H25FN4O — CID 119145068
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119145068) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119145068 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCc1c[nH]c2cc(F)ccc12)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C20H25FN4O/c1-22-20(25-10-15-16(11-25)19-5-4-18(15)26-19)23-7-6-12-9-24-17-8-13(21)2-3-14(12)17/h2-3,8-9,15-16,18-19,24H,4-7,10-11H2,1H3,(H,22,23) |
| InChIKey | RJCYUORPMIANOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|