C19H26FN5O2 — CID 111164479
ethyl 4-[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164479) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl 4-[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164479 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | ethyl 4-[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCCc2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C19H26FN5O2/c1-3-27-19(26)25-10-8-24(9-11-25)18(21-2)22-7-6-14-13-23-17-12-15(20)4-5-16(14)17/h4-5,12-13,23H,3,6-11H2,1-2H3,(H,21,22) |
| InChIKey | CRIBLYCMPBHFSL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|