C19H25F4N5 — CID 109377005
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377005) has the molecular formula C19H25F4N5 and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377005 |
| Molecular Formula | C19H25F4N5 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H25F4N5/c1-13(19(21,22)23)27-7-9-28(10-8-27)18(24-2)25-6-5-14-12-26-17-4-3-15(20)11-16(14)17/h3-4,11-13,26H,5-10H2,1-2H3,(H,24,25) |
| InChIKey | NASKLDLDMMAXFC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|