C13H22IN3OS2 — CID 119149756
1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 119149756) has the molecular formula C13H22IN3OS2 and a molecular weight of 427.38 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119149756 |
| Molecular Formula | C13H22IN3OS2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)NCC1(O)CCSC1.I |
| InChI | InChI=1S/C13H21N3OS2.HI/c1-14-12(15-6-4-11-3-2-7-19-11)16-9-13(17)5-8-18-10-13;/h2-3,7,17H,4-6,8-10H2,1H3,(H2,14,15,16);1H |
| InChIKey | LXTZCECQUXEPNL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|