C17H24FIN4OS — CID 119162811
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119162811) has the molecular formula C17H24FIN4OS and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119162811 |
| Molecular Formula | C17H24FIN4OS |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC1(O)CCSC1.I |
| InChI | InChI=1S/C17H23FN4OS.HI/c1-19-16(22-10-17(23)5-7-24-11-17)20-6-4-12-9-21-15-8-13(18)2-3-14(12)15;/h2-3,8-9,21,23H,4-7,10-11H2,1H3,(H2,19,20,22);1H |
| InChIKey | MCAOASBCHWIOSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|