C24H30FIN4O — CID 111888124
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111888124) has the molecular formula C24H30FIN4O and a molecular weight of 536.43 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888124 |
| Molecular Formula | C24H30FIN4O |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC1(c2ccccc2)CCOCC1.I |
| InChI | InChI=1S/C24H29FN4O.HI/c1-26-23(27-12-9-18-16-28-22-15-20(25)7-8-21(18)22)29-17-24(10-13-30-14-11-24)19-5-3-2-4-6-19;/h2-8,15-16,28H,9-14,17H2,1H3,(H2,26,27,29);1H |
| InChIKey | XEOWPQBDKMOOIV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|