C25H31FN4O — CID 111888791
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 111888791) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111888791 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C25H31FN4O/c1-2-27-24(28-13-10-19-17-29-23-16-21(26)8-9-22(19)23)30-18-25(11-14-31-15-12-25)20-6-4-3-5-7-20/h3-9,16-17,29H,2,10-15,18H2,1H3,(H2,27,28,30) |
| InChIKey | VLNTWHVGIHPFFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|