C19H28FN5O3S — CID 111888445
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(2-morpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111888445) has the molecular formula C19H28FN5O3S and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(2-morpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(2-morpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111888445 |
| Molecular Formula | C19H28FN5O3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(2-morpholin-4-ylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCOCC1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C19H28FN5O3S/c1-2-21-19(23-7-12-29(26,27)25-8-10-28-11-9-25)22-6-5-15-14-24-18-13-16(20)3-4-17(15)18/h3-4,13-14,24H,2,5-12H2,1H3,(H2,21,22,23) |
| InChIKey | BLZINSXQGGTCMF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|