C24H29F2IN4O — CID 111887994
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111887994) has the molecular formula C24H29F2IN4O and a molecular weight of 554.42 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111887994 |
| Molecular Formula | C24H29F2IN4O |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC1(c2ccc(F)cc2)CCOCC1.I |
| InChI | InChI=1S/C24H28F2N4O.HI/c1-27-23(28-11-8-17-15-29-22-14-20(26)6-7-21(17)22)30-16-24(9-12-31-13-10-24)18-2-4-19(25)5-3-18;/h2-7,14-15,29H,8-13,16H2,1H3,(H2,27,28,30);1H |
| InChIKey | XOMSDZGGUHOANG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|