C19H28IN5O — CID 119149886
2-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[1-(1-phenylethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 119149886) has the molecular formula C19H28IN5O and a molecular weight of 469.37 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[1-(1-phenylethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[1-(1-phenylethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119149886 |
| Molecular Formula | C19H28IN5O |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[1-(1-phenylethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C)no1)NC1CCN(C(C)c2ccccc2)C1.I |
| InChI | InChI=1S/C19H27N5O.HI/c1-14-11-18(25-23-14)12-21-19(20-3)22-17-9-10-24(13-17)15(2)16-7-5-4-6-8-16;/h4-8,11,15,17H,9-10,12-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | SIOMUUNMPFGGBT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|