C15H25F3IN5O — CID 111587154
2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111587154) has the molecular formula C15H25F3IN5O and a molecular weight of 475.30 g/mol. Its IUPAC name is 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111587154 |
| Molecular Formula | C15H25F3IN5O |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C15H24F3N5O.HI/c1-10(2)13-6-12(24-22-13)7-20-14(19-3)21-11-4-5-23(8-11)9-15(16,17)18;/h6,10-11H,4-5,7-9H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | HFROISJXOIMKAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|