C19H22IN5O2 — CID 119151942
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 119151942) has the molecular formula C19H22IN5O2 and a molecular weight of 479.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151942 |
| Molecular Formula | C19H22IN5O2 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCn1c(=O)[nH]c2ccccc21)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C19H21N5O2.HI/c20-18(22-14-9-12-26-17-8-4-1-5-13(14)17)21-10-11-24-16-7-3-2-6-15(16)23-19(24)25;/h1-8,14H,9-12H2,(H,23,25)(H3,20,21,22);1H |
| InChIKey | NCBBVVUJFBOJHQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|