C18H19NO8 — CID 11915289
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915289) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915289 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-[(1S,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@@H]1CC(=O)[C@@H](CC(=O)OCC(=O)c2ccc3c(c2)OCO3)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C18H19NO8/c1-10-4-14(20)12(13(10)7-19(23)24)6-18(22)25-8-15(21)11-2-3-16-17(5-11)27-9-26-16/h2-3,5,10,12-13H,4,6-9H2,1H3/t10-,12+,13-/m1/s1 |
| InChIKey | KEBFAVQEJPFQEV-KGYLQXTDSA-N |
| XLogP | 1.65 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|