C20H27N3O2S — CID 119153169
N'-methyl-1,1-dioxo-N-(3-phenylprop-2-ynyl)-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide (PubChem CID 119153169) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N'-methyl-1,1-dioxo-N-(3-phenylprop-2-ynyl)-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide.
| Compound Name | N'-methyl-1,1-dioxo-N-(3-phenylprop-2-ynyl)-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide |
|---|---|
| PubChem CID | 119153169 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N'-methyl-1,1-dioxo-N-(3-phenylprop-2-ynyl)-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide |
| SMILES | C/N=C(\NCC#Cc1ccccc1)N1CCS(=O)(=O)C2(CCCCC2)C1 |
| InChI | InChI=1S/C20H27N3O2S/c1-21-19(22-14-8-11-18-9-4-2-5-10-18)23-15-16-26(24,25)20(17-23)12-6-3-7-13-20/h2,4-5,9-10H,3,6-7,12-17H2,1H3,(H,21,22) |
| InChIKey | SAMSDLGHAHPTLM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|