C17H29IN4O2S2 — CID 119160999
N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide (PubChem CID 119160999) has the molecular formula C17H29IN4O2S2 and a molecular weight of 512.48 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide.
| Compound Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119160999 |
| Molecular Formula | C17H29IN4O2S2 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-N'-methyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)s1)N1CCS(=O)(=O)C2(CCCCC2)C1.I |
| InChI | InChI=1S/C17H28N4O2S2.HI/c1-13-14(2)24-15(20-13)11-19-16(18-3)21-9-10-25(22,23)17(12-21)7-5-4-6-8-17;/h4-12H2,1-3H3,(H,18,19);1H |
| InChIKey | GNQDDUWNEFGLOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|