C18H33N3O3S — CID 119154660
N'-methyl-N-[2-(oxan-4-yl)ethyl]-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide (PubChem CID 119154660) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is N'-methyl-N-[2-(oxan-4-yl)ethyl]-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide.
| Compound Name | N'-methyl-N-[2-(oxan-4-yl)ethyl]-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide |
|---|---|
| PubChem CID | 119154660 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N'-methyl-N-[2-(oxan-4-yl)ethyl]-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide |
| SMILES | C/N=C(\NCCC1CCOCC1)N1CCS(=O)(=O)C2(CCCCC2)C1 |
| InChI | InChI=1S/C18H33N3O3S/c1-19-17(20-10-5-16-6-12-24-13-7-16)21-11-14-25(22,23)18(15-21)8-3-2-4-9-18/h16H,2-15H2,1H3,(H,19,20) |
| InChIKey | PEAYDYFRCPOKCA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|