C19H27N5 — CID 119155049
2-methyl-1-[(1-methylpyrrol-2-yl)methyl]-3-(1-phenylpiperidin-4-yl)guanidine (PubChem CID 119155049) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylpyrrol-2-yl)methyl]-3-(1-phenylpiperidin-4-yl)guanidine.
| Compound Name | 2-methyl-1-[(1-methylpyrrol-2-yl)methyl]-3-(1-phenylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 119155049 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-methyl-1-[(1-methylpyrrol-2-yl)methyl]-3-(1-phenylpiperidin-4-yl)guanidine |
| SMILES | C/N=C(\NCc1cccn1C)NC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N5/c1-20-19(21-15-18-9-6-12-23(18)2)22-16-10-13-24(14-11-16)17-7-4-3-5-8-17/h3-9,12,16H,10-11,13-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | LVHWSXAAMXQQIL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|