C19H35N3O2 — CID 119155727
4-(cyclopentylmethoxy)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 119155727) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-(cyclopentylmethoxy)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-(cyclopentylmethoxy)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119155727 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 4-(cyclopentylmethoxy)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCCC1O)N1CCC(OCC2CCCC2)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-20-19(21-13-16-7-4-8-18(16)23)22-11-9-17(10-12-22)24-14-15-5-2-3-6-15/h15-18,23H,2-14H2,1H3,(H,20,21) |
| InChIKey | QATIKLJTLYBTIG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|