C16H33BrN4O — CID 146091761
3-(diethylamino)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydrobromide (PubChem CID 146091761) has the molecular formula C16H33BrN4O and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-(diethylamino)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydrobromide.
| Compound Name | 3-(diethylamino)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydrobromide |
|---|---|
| PubChem CID | 146091761 |
| Molecular Formula | C16H33BrN4O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(diethylamino)-N-[(2-hydroxycyclopentyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydrobromide |
| SMILES | Br.CCN(CC)C1CCN(/C(=N/C)NCC2CCCC2O)C1 |
| InChI | InChI=1S/C16H32N4O.BrH/c1-4-19(5-2)14-9-10-20(12-14)16(17-3)18-11-13-7-6-8-15(13)21;/h13-15,21H,4-12H2,1-3H3,(H,17,18);1H |
| InChIKey | LELXDRGEXDGEFK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|