C20H39IN4O2S — CID 119155736
N'-[2-[cyclopentyl(methyl)amino]ethyl]-N-ethyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide (PubChem CID 119155736) has the molecular formula C20H39IN4O2S and a molecular weight of 526.53 g/mol. Its IUPAC name is N'-[2-[cyclopentyl(methyl)amino]ethyl]-N-ethyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[cyclopentyl(methyl)amino]ethyl]-N-ethyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119155736 |
| Molecular Formula | C20H39IN4O2S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N'-[2-[cyclopentyl(methyl)amino]ethyl]-N-ethyl-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undecane-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)C1CCCC1)N1CCS(=O)(=O)C2(CCCCC2)C1.I |
| InChI | InChI=1S/C20H38N4O2S.HI/c1-3-21-19(22-13-14-23(2)18-9-5-6-10-18)24-15-16-27(25,26)20(17-24)11-7-4-8-12-20;/h18H,3-17H2,1-2H3,(H,21,22);1H |
| InChIKey | RVHLUMCAYZUFKY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|