C19H32IN5OS — CID 119156046
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methylguanidine;hydroiodide (PubChem CID 119156046) has the molecular formula C19H32IN5OS and a molecular weight of 505.47 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119156046 |
| Molecular Formula | C19H32IN5OS |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C(C)(C)C)cs1)NC1CCN(C(=O)C2CC2)CC1.I |
| InChI | InChI=1S/C19H31N5OS.HI/c1-19(2,3)15-12-26-16(23-15)11-21-18(20-4)22-14-7-9-24(10-8-14)17(25)13-5-6-13;/h12-14H,5-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | WYMVAIDKAIKJAO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|