C21H30FN3O — CID 119160758
N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119160758) has the molecular formula C21H30FN3O and a molecular weight of 359.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119160758 |
| Molecular Formula | C21H30FN3O |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C21H30FN3O/c1-4-23-20(24-13-21(2,3)14-6-5-7-15(22)10-14)25-11-16-17(12-25)19-9-8-18(16)26-19/h5-7,10,16-19H,4,8-9,11-13H2,1-3H3,(H,23,24) |
| InChIKey | UPSVBARYJKCXCP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|