C21H35N5S — CID 119163006
1-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 119163006) has the molecular formula C21H35N5S and a molecular weight of 389.61 g/mol. Its IUPAC name is 1-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 1-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119163006 |
| Molecular Formula | C21H35N5S |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 1-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCCN(C)C1c1cccs1)NC1CC(C)N(C2CC2)C1 |
| InChI | InChI=1S/C21H35N5S/c1-15-12-17(14-26(15)18-8-9-18)24-21(22-2)23-13-16-6-4-10-25(3)20(16)19-7-5-11-27-19/h5,7,11,15-18,20H,4,6,8-10,12-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | ULWVWRPPUIOGBP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|