C17H21ClN6S — CID 119163225
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine (PubChem CID 119163225) has the molecular formula C17H21ClN6S and a molecular weight of 376.92 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine.
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 119163225 |
| Molecular Formula | C17H21ClN6S |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cn2cc(Cl)ccc2n1)NCc1sc(C)nc1C |
| InChI | InChI=1S/C17H21ClN6S/c1-4-19-17(21-8-15-11(2)22-12(3)25-15)20-7-14-10-24-9-13(18)5-6-16(24)23-14/h5-6,9-10H,4,7-8H2,1-3H3,(H2,19,20,21) |
| InChIKey | QALIUWBXSVXFHA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|