C16H20ClIN6S — CID 119163152
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119163152) has the molecular formula C16H20ClIN6S and a molecular weight of 490.80 g/mol. Its IUPAC name is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119163152 |
| Molecular Formula | C16H20ClIN6S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2cc(Cl)ccc2n1)NCc1nc(C)c(C)s1.I |
| InChI | InChI=1S/C16H19ClN6S.HI/c1-10-11(2)24-15(21-10)7-20-16(18-3)19-6-13-9-23-8-12(17)4-5-14(23)22-13;/h4-5,8-9H,6-7H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | ZHLSMROWDKZPQB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|