C21H23FN2O4 — CID 119163719
2-(2-amino-2-oxoethoxy)-N-[1-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]benzamide (PubChem CID 119163719) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-[1-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]benzamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-[1-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 119163719 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-[1-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1OCC(N)=O)c1ccc(OCC2CC2)c(F)c1 |
| InChI | InChI=1S/C21H23FN2O4/c1-13(15-8-9-19(17(22)10-15)27-11-14-6-7-14)24-21(26)16-4-2-3-5-18(16)28-12-20(23)25/h2-5,8-10,13-14H,6-7,11-12H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | NUJMDIBYIFXYFX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |