C19H22N2O4 — CID 24582222
2-(2-amino-2-oxoethoxy)-N-[1-(4-ethoxyphenyl)ethyl]benzamide (PubChem CID 24582222) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-[1-(4-ethoxyphenyl)ethyl]benzamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-[1-(4-ethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24582222 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-[1-(4-ethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1ccc(C(C)NC(=O)c2ccccc2OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-3-24-15-10-8-14(9-11-15)13(2)21-19(23)16-6-4-5-7-17(16)25-12-18(20)22/h4-11,13H,3,12H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | MWOKHBCGOIZUKY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |