C12H12N4O3S — CID 119170775
4-[(2-pyrimidin-2-yl-1,3-thiazole-5-carbonyl)amino]butanoic acid (PubChem CID 119170775) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-[(2-pyrimidin-2-yl-1,3-thiazole-5-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2-pyrimidin-2-yl-1,3-thiazole-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119170775 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-[(2-pyrimidin-2-yl-1,3-thiazole-5-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1cnc(-c2ncccn2)s1 |
| InChI | InChI=1S/C12H12N4O3S/c17-9(18)3-1-4-15-11(19)8-7-16-12(20-8)10-13-5-2-6-14-10/h2,5-7H,1,3-4H2,(H,15,19)(H,17,18) |
| InChIKey | VDPPFQKQRZNJBS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|