C12H15F3N2O4S — CID 119171134
4-[[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoyl]amino]butanoic acid (PubChem CID 119171134) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is 4-[[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoyl]amino]butanoic acid.
| Compound Name | 4-[[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119171134 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-[[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoyl]amino]butanoic acid |
| SMILES | Cc1csc(C(O)(CC(=O)NCCCC(=O)O)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N2O4S/c1-7-6-22-10(17-7)11(21,12(13,14)15)5-8(18)16-4-2-3-9(19)20/h6,21H,2-5H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | AIKHPCBOTBVFDI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|