C15H15F3N2O3S — CID 51128862
4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-phenylmethoxybutanamide (PubChem CID 51128862) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-phenylmethoxybutanamide.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 51128862 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-phenylmethoxybutanamide |
| SMILES | Cc1csc(C(O)(CC(=O)NOCc2ccccc2)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-10-9-24-13(19-10)14(22,15(16,17)18)7-12(21)20-23-8-11-5-3-2-4-6-11/h2-6,9,22H,7-8H2,1H3,(H,20,21) |
| InChIKey | HDBMJJYEHRIROL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|