C15H15F3N2O3S — CID 47840722
4,4,4-trifluoro-3-hydroxy-N-(2-hydroxy-4-methylphenyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 47840722) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-N-(2-hydroxy-4-methylphenyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-N-(2-hydroxy-4-methylphenyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 47840722 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-N-(2-hydroxy-4-methylphenyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1ccc(NC(=O)CC(O)(c2nc(C)cs2)C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-8-3-4-10(11(21)5-8)20-12(22)6-14(23,15(16,17)18)13-19-9(2)7-24-13/h3-5,7,21,23H,6H2,1-2H3,(H,20,22) |
| InChIKey | JLRCTWAUAXJZAD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|