C14H17F3N4O2S2 — CID 47841743
4,4,4-trifluoro-3-hydroxy-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 47841743) has the molecular formula C14H17F3N4O2S2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 47841743 |
| Molecular Formula | C14H17F3N4O2S2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1csc(C(O)(CC(=O)Nc2nnc(CC(C)C)s2)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H17F3N4O2S2/c1-7(2)4-10-20-21-12(25-10)19-9(22)5-13(23,14(15,16)17)11-18-8(3)6-24-11/h6-7,23H,4-5H2,1-3H3,(H,19,21,22) |
| InChIKey | XZKBFMOEVUZURR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |