C14H16F3N3O3S — CID 95359193
(3R)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 95359193) has the molecular formula C14H16F3N3O3S and a molecular weight of 363.36 g/mol. Its IUPAC name is (3R)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | (3R)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 95359193 |
| Molecular Formula | C14H16F3N3O3S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (3R)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1csc([C@@](O)(CC(=O)NCc2c(C)noc2C)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H16F3N3O3S/c1-7-6-24-12(19-7)13(22,14(15,16)17)4-11(21)18-5-10-8(2)20-23-9(10)3/h6,22H,4-5H2,1-3H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | ZWRUGZSMTRMHIC-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |