C15H20N2O4S — CID 119171954
2-[(2-benzamido-4-methylsulfanylbutanoyl)-methylamino]acetic acid (PubChem CID 119171954) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[(2-benzamido-4-methylsulfanylbutanoyl)-methylamino]acetic acid.
| Compound Name | 2-[(2-benzamido-4-methylsulfanylbutanoyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 119171954 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[(2-benzamido-4-methylsulfanylbutanoyl)-methylamino]acetic acid |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C15H20N2O4S/c1-17(10-13(18)19)15(21)12(8-9-22-2)16-14(20)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | DKHZVGGNOWEDPH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |