C20H28N3O2S+ — CID 11917842
4-(1,3-benzodioxol-5-ylmethyl)-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbothioamide (PubChem CID 11917842) has the molecular formula C20H28N3O2S+ and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 11917842 |
| Molecular Formula | C20H28N3O2S+ |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbothioamide |
| SMILES | S=C(N[C@H]1C[C@H]2CC[C@@H]1C2)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H27N3O2S/c26-20(21-17-10-14-1-3-16(17)9-14)23-7-5-22(6-8-23)12-15-2-4-18-19(11-15)25-13-24-18/h2,4,11,14,16-17H,1,3,5-10,12-13H2,(H,21,26)/p+1/t14-,16+,17-/m0/s1 |
| InChIKey | DSTYRSYHTVOIEM-UAGQMJEPSA-O |
| XLogP | 1.18 |
| TPSA | 38.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|