C23H22BrN2O3S+ — CID 2455028
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-[5-(4-bromophenyl)furan-2-yl]methanethione (PubChem CID 2455028) has the molecular formula C23H22BrN2O3S+ and a molecular weight of 486.41 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-[5-(4-bromophenyl)furan-2-yl]methanethione.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-[5-(4-bromophenyl)furan-2-yl]methanethione |
|---|---|
| PubChem CID | 2455028 |
| Molecular Formula | C23H22BrN2O3S+ |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-[5-(4-bromophenyl)furan-2-yl]methanethione |
| SMILES | S=C(c1ccc(-c2ccc(Br)cc2)o1)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H21BrN2O3S/c24-18-4-2-17(3-5-18)19-7-8-21(29-19)23(30)26-11-9-25(10-12-26)14-16-1-6-20-22(13-16)28-15-27-20/h1-8,13H,9-12,14-15H2/p+1 |
| InChIKey | IBMFJOHLDOMDLB-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 39.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_amide_A(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|